Products 1445951-68-7

CAS 1445951-68-7 is the registry number for 8-tert-Butyl 4-ethyl 3-oxo-2,8-diazaspiro[4.5]decane-4,8-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

8-O-tert-butyl 4-O-ethyl 3-oxo-2,8-diazaspiro[4.5]decane-4,8-dicarboxylate (CAS 1445951-68-7) is a chemical compound with the molecular formula C16H26N2O5 and a molecular weight of 326.39 g/mol. IUPAC name: 8-O-tert-butyl 4-O-ethyl 3-oxo-2,8-diazaspiro[4.5]decane-4,8-dicarboxylate. InChIKey: GCAUESGDXGLLIE-UHFFFAOYSA-N.

Identity
Molecular formulaC16H26N2O5
Molecular weight326.39 g/mol
IUPAC name8-O-tert-butyl 4-O-ethyl 3-oxo-2,8-diazaspiro[4.5]decane-4,8-dicarboxylate
InChIKeyGCAUESGDXGLLIE-UHFFFAOYSA-N
SMILESCCOC(=O)C1C(=O)NCC12CCN(CC2)C(=O)OC(C)(C)C

Computed by PubChem (NCBI)