CAS 874447-72-0 is the registry number for Di-tert-butyl (1S,5R)-2-oxo-3,8-diazabicyclo[3.2.1]octane-3,8-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ditert-butyl (1S,5R)-2-oxo-3,8-diazabicyclo[3.2.1]octane-3,8-dicarboxylate (CAS 874447-72-0) is a chemical compound with the molecular formula C16H26N2O5 and a molecular weight of 326.39 g/mol. IUPAC name: ditert-butyl (1S,5R)-2-oxo-3,8-diazabicyclo[3.2.1]octane-3,8-dicarboxylate. InChIKey: RUGREBZCMHXQNA-MNOVXSKESA-N.
| Molecular formula | C16H26N2O5 |
|---|---|
| Molecular weight | 326.39 g/mol |
| IUPAC name | ditert-butyl (1S,5R)-2-oxo-3,8-diazabicyclo[3.2.1]octane-3,8-dicarboxylate |
| InChIKey | RUGREBZCMHXQNA-MNOVXSKESA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]2CC[C@@H](C1=O)N2C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)