Products 1149757-30-1
CAS 1149757-30-1 is the registry number for Ramelteon Impurity 10. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(4S)-4-phenyl-3-[2-[(8S)-2,6,7,8-tetrahydro-1H-cyclopenta[e][1]benzofuran-8-yl]acetyl]-1,3-oxazolidin-2-one (CAS 1149757-30-1) is a chemical compound with the molecular formula C22H21NO4 and a molecular weight of 363.4 g/mol. IUPAC name: (4S)-4-phenyl-3-[2-[(8S)-2,6,7,8-tetrahydro-1H-cyclopenta[e][1]benzofuran-8-yl]acetyl]-1,3-oxazolidin-2-one. InChIKey: QZQZKOLIBWKGIP-FUHWJXTLSA-N.
| Molecular formula | C22H21NO4 |
|---|---|
| Molecular weight | 363.4 g/mol |
| IUPAC name | (4S)-4-phenyl-3-[2-[(8S)-2,6,7,8-tetrahydro-1H-cyclopenta[e][1]benzofuran-8-yl]acetyl]-1,3-oxazolidin-2-one |
| InChIKey | QZQZKOLIBWKGIP-FUHWJXTLSA-N |
| SMILES | C1CC2=C([C@@H]1CC(=O)N3[C@H](COC3=O)C4=CC=CC=C4)C5=C(C=C2)OCC5 |
Computed by PubChem (NCBI)
Synonyms:
Ramelteon Impurity 69