Products 219786-80-8

CAS 219786-80-8 is the registry number for Dimethyl 1-benzyl-4-phenyl-1,4-dihydropyridine-3,5-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Dimethyl 1-benzyl-4-phenyl-4H-pyridine-3,5-dicarboxylate (CAS 219786-80-8) is a chemical compound with the molecular formula C22H21NO4 and a molecular weight of 363.4 g/mol. IUPAC name: dimethyl 1-benzyl-4-phenyl-4H-pyridine-3,5-dicarboxylate. InChIKey: HNIXBTPEAHAZJX-UHFFFAOYSA-N.

Identity
Molecular formulaC22H21NO4
Molecular weight363.4 g/mol
IUPAC namedimethyl 1-benzyl-4-phenyl-4H-pyridine-3,5-dicarboxylate
InChIKeyHNIXBTPEAHAZJX-UHFFFAOYSA-N
SMILESCOC(=O)C1=CN(C=C(C1C2=CC=CC=C2)C(=O)OC)CC3=CC=CC=C3

Computed by PubChem (NCBI)