CAS 1192030-17-3 is the registry number for (E)-3-(3-(4-(Diethylamino)phenyl)acryloyl)-4-hydroxy-2H-chromen-2-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[(E)-3-[4-(diethylamino)phenyl]prop-2-enoyl]-4-hydroxychromen-2-one (CAS 1192030-17-3) is a chemical compound with the molecular formula C22H21NO4 and a molecular weight of 363.4 g/mol. IUPAC name: 3-[(E)-3-[4-(diethylamino)phenyl]prop-2-enoyl]-4-hydroxychromen-2-one. InChIKey: IEOHVJFNSMXQEA-SDNWHVSQSA-N.
| Molecular formula | C22H21NO4 |
|---|---|
| Molecular weight | 363.4 g/mol |
| IUPAC name | 3-[(E)-3-[4-(diethylamino)phenyl]prop-2-enoyl]-4-hydroxychromen-2-one |
| InChIKey | IEOHVJFNSMXQEA-SDNWHVSQSA-N |
| SMILES | CCN(CC)C1=CC=C(C=C1)/C=C/C(=O)C2=C(C3=CC=CC=C3OC2=O)O |
Computed by PubChem (NCBI)