CAS 928773-42-6 appears in our catalog under these names: Chromone-6-boronic acid pinacol ester, 97%, 6-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-4H-chromen-4-one 95%, CHROMONE-6-BORONIC ACID PINACOL ESTER, 95%, 95%, 6-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-4h-chromen-4-one, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 50mg, 100mg.
6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)chromen-4-one (CAS 928773-42-6) is a chemical compound with the molecular formula C15H17BO4 and a molecular weight of 272.11 g/mol. IUPAC name: 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)chromen-4-one. InChIKey: MCLPUBULQFSMMG-UHFFFAOYSA-N.
| Molecular formula | C15H17BO4 |
|---|---|
| Molecular weight | 272.11 g/mol |
| IUPAC name | 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)chromen-4-one |
| InChIKey | MCLPUBULQFSMMG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)OC=CC3=O |
Computed by PubChem (NCBI)