Products 1655495-95-6
CAS 1655495-95-6 is the registry number for 8-(tetramethyl-1,3,2-dioxaborolan-2-yl)-4H-chromen-4-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)chromen-4-one (CAS 1655495-95-6) is a chemical compound with the molecular formula C15H17BO4 and a molecular weight of 272.11 g/mol. IUPAC name: 8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)chromen-4-one. InChIKey: KQTPZBIJBSLTPA-UHFFFAOYSA-N.
| Molecular formula | C15H17BO4 |
|---|---|
| Molecular weight | 272.11 g/mol |
| IUPAC name | 8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)chromen-4-one |
| InChIKey | KQTPZBIJBSLTPA-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C3C(=CC=C2)C(=O)C=CO3 |
Computed by PubChem (NCBI)