CAS 1150114-63-8 appears in our catalog under these names: 2-Fluoro-6-(trifluoromethyl)pyridine-3-boronic acid, 98%, 2-Fluoro-6-(trifluoromethyl)pyridine-3-boronic Acid, >95% (HPLC), 2–Fluoro–6–(trifluoromethyl)pyridine–3–boronic Acid, 2-Fluoro-6-(trifluoroMethyl)pyridine-3-boronic acid, 2-Fluoro-6-(trifluoromethyl)pyridine-3-boronic acid, 95%, 95%. Offered by: Combi-blocks, TRC, GLPBio, Biosynth, Chemat. Available pack sizes: 1g, 250mg, 100mg, 25mg, 5g.
[2-fluoro-6-(trifluoromethyl)-3-pyridinyl]boronic acid (CAS 1150114-63-8) is a chemical compound with the molecular formula C6H4BF4NO2 and a molecular weight of 208.91 g/mol. IUPAC name: [2-fluoro-6-(trifluoromethyl)-3-pyridinyl]boronic acid. InChIKey: JLKCXRRPVZUFJB-UHFFFAOYSA-N.
| Molecular formula | C6H4BF4NO2 |
|---|---|
| Molecular weight | 208.91 g/mol |
| IUPAC name | [2-fluoro-6-(trifluoromethyl)-3-pyridinyl]boronic acid |
| InChIKey | JLKCXRRPVZUFJB-UHFFFAOYSA-N |
| SMILES | B(C1=C(N=C(C=C1)C(F)(F)F)F)(O)O |
Computed by PubChem (NCBI)