CAS 1701432-08-7 appears in our catalog under these names: (5-Fluoro-6-(trifluoromethyl)pyridin-3-yl)boronic acid, 98%, [5-fluoro-6-(trifluoromethyl)pyridin-3-yl]boronic acid, >95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg.
[5-fluoro-6-(trifluoromethyl)-3-pyridinyl]boronic acid (CAS 1701432-08-7) is a chemical compound with the molecular formula C6H4BF4NO2 and a molecular weight of 208.91 g/mol. IUPAC name: [5-fluoro-6-(trifluoromethyl)-3-pyridinyl]boronic acid. InChIKey: FIJNSXOMCNJYRC-UHFFFAOYSA-N.
| Molecular formula | C6H4BF4NO2 |
|---|---|
| Molecular weight | 208.91 g/mol |
| IUPAC name | [5-fluoro-6-(trifluoromethyl)-3-pyridinyl]boronic acid |
| InChIKey | FIJNSXOMCNJYRC-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(N=C1)C(F)(F)F)F)(O)O |
Computed by PubChem (NCBI)