CAS 2657618-04-5 appears in our catalog under these names: (2-Amino-3,4,5,6-tetrafluorophenyl)boronic acid, 98%, (2-Amino-3,4,5,6-tetrafluorophenyl)boronic acid, 95%, 95%, (2-Amino-3,4,5,6-tetrafluorophenyl)boronic acid, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
(2-amino-3,4,5,6-tetrafluorophenyl)boronic acid (CAS 2657618-04-5) is a chemical compound with the molecular formula C6H4BF4NO2 and a molecular weight of 208.91 g/mol. IUPAC name: (2-amino-3,4,5,6-tetrafluorophenyl)boronic acid. InChIKey: NDGUMEQRENKJPA-UHFFFAOYSA-N.
| Molecular formula | C6H4BF4NO2 |
|---|---|
| Molecular weight | 208.91 g/mol |
| IUPAC name | (2-amino-3,4,5,6-tetrafluorophenyl)boronic acid |
| InChIKey | NDGUMEQRENKJPA-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C(=C1F)F)F)F)N)(O)O |
Computed by PubChem (NCBI)