Products 115016-95-0
CAS 115016-95-0 appears in our catalog under these names: (S)-2-Hydroxy-4-phenylbutyric Acid, >95% (HPLC), (S)–2–Hydroxy–4–phenylbutyric Acid, (S)-2-Hydroxy-4-phenylbutyric acid 97%, (S)-2-Hydroxy-4-phenylbutyric acid, 97%, 97%, (S)-2-Hydroxy-4-phenylbutyric acid, 97%. Offered by: TRC, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 25mg, 1g, 250mg, 5g, 10g, 25g, 100g.
(2S)-2-hydroxy-4-phenylbutanoic acid (CAS 115016-95-0) is a chemical compound with the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. IUPAC name: (2S)-2-hydroxy-4-phenylbutanoic acid. InChIKey: JNJCEALGCZSIGB-VIFPVBQESA-N.
| Molecular formula | C10H12O3 |
|---|---|
| Molecular weight | 180.20 g/mol |
| IUPAC name | (2S)-2-hydroxy-4-phenylbutanoic acid |
| InChIKey | JNJCEALGCZSIGB-VIFPVBQESA-N |
| SMILES | C1=CC=C(C=C1)CC[C@@H](C(=O)O)O |
Computed by PubChem (NCBI)
Synonyms:
Benzenebutanoic acid, alpha-hydroxy-, (alphaS)-, 2-Hydroxy-4-phenylbutyric acid, (S)-, 2-Hydroxy-4-phenylbutyric acid, (+)-, L-4-phenyl-alpha-hydroxybutyric acid, (alphaS)-alpha-Hydroxybenzenebutanoic acid, (.ALPHA.S)-.ALPHA.-HYDROXYBENZENEBUTANOIC ACID, BENZENEBUTANOIC ACID, .ALPHA.-HYDROXY-, (.ALPHA.S)-, (S)-2-Hydroxy-4-phenylbutyric Acid, (2S)-2-hydroxy-4-phenylbutanoic acid, (s)-2-hydroxy-4-phenylbutanoic acid