CAS 1286987-57-2 is the registry number for (R)-2-Hydroxy-4-phenylbutyric Acid-d5. Offered by: TRC. Available pack sizes: 50mg, 5mg.
(2R)-2-hydroxy-4-(2,3,4,5,6-pentadeuteriophenyl)butanoic acid (CAS 1286987-57-2) is a chemical compound with the molecular formula C10H12O3 and a molecular weight of 185.23 g/mol. IUPAC name: (2R)-2-hydroxy-4-(2,3,4,5,6-pentadeuteriophenyl)butanoic acid. InChIKey: JNJCEALGCZSIGB-JEWAYBISSA-N.
| Molecular formula | C10H12O3 |
|---|---|
| Molecular weight | 185.23 g/mol |
| IUPAC name | (2R)-2-hydroxy-4-(2,3,4,5,6-pentadeuteriophenyl)butanoic acid |
| InChIKey | JNJCEALGCZSIGB-JEWAYBISSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])CC[C@H](C(=O)O)O)[2H])[2H] |
Computed by PubChem (NCBI)