Products 29678-81-7
CAS 29678-81-7 appears in our catalog under these names: (R)–2–Hydroxy–4–phenylbutyric Acid, (R)-2-Hydroxy-4-phenylbutyric Acid, >97.0%(GC)(T), (R)-2-Hydroxy-4-phenylbutanoic acid, (R)-2-Hydroxy-4-phenylbutyric acid 98%, (R)-2-Hydroxy-4-phenylbutyric acid, 98%, 98%. Offered by: GLPBio, TCI, Biosynth, Ambeed, Chemat. Available pack sizes: 100g, 10g, 25g, 1g, 5g, 250g, 500g.
(2R)-2-hydroxy-4-phenylbutanoic acid (CAS 29678-81-7) is a chemical compound with the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. IUPAC name: (2R)-2-hydroxy-4-phenylbutanoic acid. InChIKey: JNJCEALGCZSIGB-SECBINFHSA-N.
| Molecular formula | C10H12O3 |
|---|---|
| Molecular weight | 180.20 g/mol |
| IUPAC name | (2R)-2-hydroxy-4-phenylbutanoic acid |
| InChIKey | JNJCEALGCZSIGB-SECBINFHSA-N |
| SMILES | C1=CC=C(C=C1)CC[C@H](C(=O)O)O |
Computed by PubChem (NCBI)
Synonyms:
(R)-2-Hydroxy-4-phenylbutyric acid, (R)-2-hydroxy-4-phenylbutanoic acid, (2R)-2-hydroxy-4-phenylbutanoic acid, (R)-(-)-2-Hydroxy-4-phenylbutyric acid, D-(-)-Benzyllactic acid, Benzenebutanoic acid, alpha-hydroxy-, (alphaR)-, (alphaR)-Hydroxy-benzenebutanoic Acid, 2-Hydroxy-4-phenylbutyric acid, (R)-, (2R)-2-Hydroxy-4-phenyl-butanoic acid, 2-Hydroxy-4-phenylbutyric acid, (-)-