Products 1150164-37-6
CAS 1150164-37-6 is the registry number for Methyl 5-tert-butyl-1-(6-chloropyridin-2-yl)pyrazole-4-carboxylate, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl 5-tert-butyl-1-(6-chloro-2-pyridinyl)pyrazole-4-carboxylate (CAS 1150164-37-6) is a chemical compound with the molecular formula C14H16ClN3O2 and a molecular weight of 293.75 g/mol. IUPAC name: methyl 5-tert-butyl-1-(6-chloro-2-pyridinyl)pyrazole-4-carboxylate. InChIKey: DPWMHTOIURWYFO-UHFFFAOYSA-N.
| Molecular formula | C14H16ClN3O2 |
|---|---|
| Molecular weight | 293.75 g/mol |
| IUPAC name | methyl 5-tert-butyl-1-(6-chloro-2-pyridinyl)pyrazole-4-carboxylate |
| InChIKey | DPWMHTOIURWYFO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=C(C=NN1C2=NC(=CC=C2)Cl)C(=O)OC |
Computed by PubChem (NCBI)