Products 2677885-96-8
CAS 2677885-96-8 is the registry number for tert-butyl N-[(2-chloro-1,6-naphthyridin-7-yl)methyl] carbamate, 97%, 97%. Offered by: Chemat. Available pack sizes: 5g, 100mg, 250mg, 500mg, 1g.
Tert-butyl N-[(2-chloro-1,6-naphthyridin-7-yl)methyl]carbamate (CAS 2677885-96-8) is a chemical compound with the molecular formula C14H16ClN3O2 and a molecular weight of 293.75 g/mol. IUPAC name: tert-butyl N-[(2-chloro-1,6-naphthyridin-7-yl)methyl]carbamate. InChIKey: PBEVZRGCNZPKHH-UHFFFAOYSA-N.
| Molecular formula | C14H16ClN3O2 |
|---|---|
| Molecular weight | 293.75 g/mol |
| IUPAC name | tert-butyl N-[(2-chloro-1,6-naphthyridin-7-yl)methyl]carbamate |
| InChIKey | PBEVZRGCNZPKHH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1=CC2=C(C=CC(=N2)Cl)C=N1 |
Computed by PubChem (NCBI)