CAS 19854-82-1 is the registry number for 3-Chloro-n-(1,5-dimethyl-3-oxo-2-phenyl-2,3-dihydro-1h-pyrazol-4-yl)propanamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-chloro-N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)propanamide (CAS 19854-82-1) is a chemical compound with the molecular formula C14H16ClN3O2 and a molecular weight of 293.75 g/mol. IUPAC name: 3-chloro-N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)propanamide. InChIKey: SIIXXURPQMSLGR-UHFFFAOYSA-N.
| Molecular formula | C14H16ClN3O2 |
|---|---|
| Molecular weight | 293.75 g/mol |
| IUPAC name | 3-chloro-N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)propanamide |
| InChIKey | SIIXXURPQMSLGR-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)N(N1C)C2=CC=CC=C2)NC(=O)CCCl |
Computed by PubChem (NCBI)