CAS 1150271-59-2 is the registry number for 5-Acetyl-2,3-methylenedioxophenylboronic acid, pinacol ester, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
1-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzodioxol-5-yl]ethanone (CAS 1150271-59-2) is a chemical compound with the molecular formula C15H19BO5 and a molecular weight of 290.12 g/mol. IUPAC name: 1-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzodioxol-5-yl]ethanone. InChIKey: AZCKRWLNQMTQCO-UHFFFAOYSA-N.
| Molecular formula | C15H19BO5 |
|---|---|
| Molecular weight | 290.12 g/mol |
| IUPAC name | 1-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzodioxol-5-yl]ethanone |
| InChIKey | AZCKRWLNQMTQCO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC3=C2OCO3)C(=O)C |
Computed by PubChem (NCBI)