Products 1349171-53-4
CAS 1349171-53-4 appears in our catalog under these names: Methyl 4-formyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate, 97%, 97%, (2-FORMYL-5-(METHOXYCARBONYL)PHENYL)BORONIC ACID PINACOL ESTER, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
Methyl 4-formyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (CAS 1349171-53-4) is a chemical compound with the molecular formula C15H19BO5 and a molecular weight of 290.12 g/mol. IUPAC name: methyl 4-formyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate. InChIKey: WECNMHGEYTZLRW-UHFFFAOYSA-N.
| Molecular formula | C15H19BO5 |
|---|---|
| Molecular weight | 290.12 g/mol |
| IUPAC name | methyl 4-formyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| InChIKey | WECNMHGEYTZLRW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)C(=O)OC)C=O |
Computed by PubChem (NCBI)