CAS 35413-59-3 is the registry number for Gibberellic Acid Methyl Ester 2-p-Toluenesulfonate. Offered by: TRC. Available pack sizes: 100mg, 25mg, 50mg.
1-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzodioxol-5-yl]ethanone (CAS 35413-59-3) is a chemical compound with the molecular formula C15H19BO5 and a molecular weight of 290.12 g/mol. IUPAC name: 1-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzodioxol-5-yl]ethanone. InChIKey: AZCKRWLNQMTQCO-UHFFFAOYSA-N.
| Molecular formula | C15H19BO5 |
|---|---|
| Molecular weight | 290.12 g/mol |
| IUPAC name | 1-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzodioxol-5-yl]ethanone |
| InChIKey | AZCKRWLNQMTQCO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC3=C2OCO3)C(=O)C |
Computed by PubChem (NCBI)