CAS 1150271-76-3 appears in our catalog under these names: 2-Fluoro-4,5-dimethoxyphenylboronic acid, pinacol ester, 95%, 2-(2-Fluoro-4,5-dimethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%, 2–Fluoro–4,5–dimethoxyphenylboronic acid, pinacol ester. Offered by: Combi-blocks, AmBeed, GLPBio, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 500mg.
2-(2-fluoro-4,5-dimethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1150271-76-3) is a chemical compound with the molecular formula C14H20BFO4 and a molecular weight of 282.12 g/mol. IUPAC name: 2-(2-fluoro-4,5-dimethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: SMHDJMCPSMSTJD-UHFFFAOYSA-N.
| Molecular formula | C14H20BFO4 |
|---|---|
| Molecular weight | 282.12 g/mol |
| IUPAC name | 2-(2-fluoro-4,5-dimethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | SMHDJMCPSMSTJD-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2F)OC)OC |
Computed by PubChem (NCBI)