CAS 2121512-21-6 is the registry number for 2,3-Dimethoxy-4-fluorophenylboronic acid pinacol ester, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 250mg, 1g.
2-(4-fluoro-2,3-dimethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2121512-21-6) is a chemical compound with the molecular formula C14H20BFO4 and a molecular weight of 282.12 g/mol. IUPAC name: 2-(4-fluoro-2,3-dimethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: RTHLFDVSFZWBFU-UHFFFAOYSA-N.
| Molecular formula | C14H20BFO4 |
|---|---|
| Molecular weight | 282.12 g/mol |
| IUPAC name | 2-(4-fluoro-2,3-dimethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | RTHLFDVSFZWBFU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=C(C=C2)F)OC)OC |
Computed by PubChem (NCBI)