CAS 2377609-46-4 is the registry number for 3-Fluoro-2,4-dimethoxyphenylboronic acid pinacol ester, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2-(3-fluoro-2,4-dimethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2377609-46-4) is a chemical compound with the molecular formula C14H20BFO4 and a molecular weight of 282.12 g/mol. IUPAC name: 2-(3-fluoro-2,4-dimethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: KDKDMYCFUGCCDL-UHFFFAOYSA-N.
| Molecular formula | C14H20BFO4 |
|---|---|
| Molecular weight | 282.12 g/mol |
| IUPAC name | 2-(3-fluoro-2,4-dimethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | KDKDMYCFUGCCDL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=C(C=C2)OC)F)OC |
Computed by PubChem (NCBI)