CAS 2225152-78-1 is the registry number for 5–Chloro–6–(2–methylpiperidin–1–yl)pyridine–3–boronic acid. Offered by: GLPBio. Available pack sizes: 10mg, 25mg.
[5-chloro-6-(2-methylpiperidin-1-yl)-3-pyridinyl]boronic acid (CAS 2225152-78-1) is a chemical compound with the molecular formula C11H16BClN2O2 and a molecular weight of 254.52 g/mol. IUPAC name: [5-chloro-6-(2-methylpiperidin-1-yl)-3-pyridinyl]boronic acid. InChIKey: GXHVQHSMLAUTMC-UHFFFAOYSA-N.
| Molecular formula | C11H16BClN2O2 |
|---|---|
| Molecular weight | 254.52 g/mol |
| IUPAC name | [5-chloro-6-(2-methylpiperidin-1-yl)-3-pyridinyl]boronic acid |
| InChIKey | GXHVQHSMLAUTMC-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(N=C1)N2CCCCC2C)Cl)(O)O |
Computed by PubChem (NCBI)