Products 1150618-17-9
CAS 1150618-17-9 is the registry number for Di-tert-butyl 2,6-diazaspiro(3.3)heptane-2,6-dicarboxylate. Offered by: Biosynth. Available pack sizes: 1000mg, 5000mg.
Ditert-butyl 2,6-diazaspiro[3.3]heptane-2,6-dicarboxylate (CAS 1150618-17-9) is a chemical compound with the molecular formula C15H26N2O4 and a molecular weight of 298.38 g/mol. IUPAC name: ditert-butyl 2,6-diazaspiro[3.3]heptane-2,6-dicarboxylate. InChIKey: ONCGJNFACJSGIN-UHFFFAOYSA-N.
| Molecular formula | C15H26N2O4 |
|---|---|
| Molecular weight | 298.38 g/mol |
| IUPAC name | ditert-butyl 2,6-diazaspiro[3.3]heptane-2,6-dicarboxylate |
| InChIKey | ONCGJNFACJSGIN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(C1)CN(C2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)