Products 1150703-55-1

CAS 1150703-55-1 is the registry number for 1-(3-Fluorobenzyl)-5-methyl-1h-1,2,3-triazole-4-carboxylic acid, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

1-[(3-fluorophenyl)methyl]-5-methyltriazole-4-carboxylic acid (CAS 1150703-55-1) is a chemical compound with the molecular formula C11H10FN3O2 and a molecular weight of 235.21 g/mol. IUPAC name: 1-[(3-fluorophenyl)methyl]-5-methyltriazole-4-carboxylic acid. InChIKey: SKINLZKUUMTHQE-UHFFFAOYSA-N.

Identity
Molecular formulaC11H10FN3O2
Molecular weight235.21 g/mol
IUPAC name1-[(3-fluorophenyl)methyl]-5-methyltriazole-4-carboxylic acid
InChIKeySKINLZKUUMTHQE-UHFFFAOYSA-N
SMILESCC1=C(N=NN1CC2=CC(=CC=C2)F)C(=O)O

Computed by PubChem (NCBI)