CAS 1406504-29-7 is the registry number for Ethyl 5-(4-fluorophenyl)-1H-1,2,4-triazole-3-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 3-(4-fluorophenyl)-1H-1,2,4-triazole-5-carboxylate (CAS 1406504-29-7) is a chemical compound with the molecular formula C11H10FN3O2 and a molecular weight of 235.21 g/mol. IUPAC name: ethyl 3-(4-fluorophenyl)-1H-1,2,4-triazole-5-carboxylate. InChIKey: HYUHVWWMBXKVKE-UHFFFAOYSA-N.
| Molecular formula | C11H10FN3O2 |
|---|---|
| Molecular weight | 235.21 g/mol |
| IUPAC name | ethyl 3-(4-fluorophenyl)-1H-1,2,4-triazole-5-carboxylate |
| InChIKey | HYUHVWWMBXKVKE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC(=NN1)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)