CAS 1774901-06-2 is the registry number for Methyl 1-(3-fluorophenyl)-5-methyl-1h-1,2,4-triazole-3-carboxylate, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Methyl 1-(3-fluorophenyl)-5-methyl-1,2,4-triazole-3-carboxylate (CAS 1774901-06-2) is a chemical compound with the molecular formula C11H10FN3O2 and a molecular weight of 235.21 g/mol. IUPAC name: methyl 1-(3-fluorophenyl)-5-methyl-1,2,4-triazole-3-carboxylate. InChIKey: CLSWPSLOYNGZMV-UHFFFAOYSA-N.
| Molecular formula | C11H10FN3O2 |
|---|---|
| Molecular weight | 235.21 g/mol |
| IUPAC name | methyl 1-(3-fluorophenyl)-5-methyl-1,2,4-triazole-3-carboxylate |
| InChIKey | CLSWPSLOYNGZMV-UHFFFAOYSA-N |
| SMILES | CC1=NC(=NN1C2=CC(=CC=C2)F)C(=O)OC |
Computed by PubChem (NCBI)