Products 1774901-06-2

CAS 1774901-06-2 is the registry number for Methyl 1-(3-fluorophenyl)-5-methyl-1h-1,2,4-triazole-3-carboxylate, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

Methyl 1-(3-fluorophenyl)-5-methyl-1,2,4-triazole-3-carboxylate (CAS 1774901-06-2) is a chemical compound with the molecular formula C11H10FN3O2 and a molecular weight of 235.21 g/mol. IUPAC name: methyl 1-(3-fluorophenyl)-5-methyl-1,2,4-triazole-3-carboxylate. InChIKey: CLSWPSLOYNGZMV-UHFFFAOYSA-N.

Identity
Molecular formulaC11H10FN3O2
Molecular weight235.21 g/mol
IUPAC namemethyl 1-(3-fluorophenyl)-5-methyl-1,2,4-triazole-3-carboxylate
InChIKeyCLSWPSLOYNGZMV-UHFFFAOYSA-N
SMILESCC1=NC(=NN1C2=CC(=CC=C2)F)C(=O)OC

Computed by PubChem (NCBI)