CAS 115104-40-0 appears in our catalog under these names: 3-(2-(7-Chloroquinolin-2-yl)vinyl)benzaldehyde, 95%, 3-(2-(7-Chloroquinolin-2-yl)vinyl)benzaldehyde, 95% mix TBC as stabilizer, 3–(2–(7–Chloroquinolin–2–yl)vinyl)benzaldehyde. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 100mg, 250mg, 1g.
3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]benzaldehyde (CAS 115104-40-0) is a chemical compound with the molecular formula C18H12ClNO and a molecular weight of 293.7 g/mol. IUPAC name: 3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]benzaldehyde. InChIKey: JTRDWIOIDMLMNN-XBXARRHUSA-N.
| Molecular formula | C18H12ClNO |
|---|---|
| Molecular weight | 293.7 g/mol |
| IUPAC name | 3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]benzaldehyde |
| InChIKey | JTRDWIOIDMLMNN-XBXARRHUSA-N |
| SMILES | C1=CC(=CC(=C1)C=O)/C=C/C2=NC3=C(C=CC(=C3)Cl)C=C2 |
Computed by PubChem (NCBI)