CAS 80100-09-0 appears in our catalog under these names: [1,1'-Biphenyl]-4-yl(2-chloropyridin-4-yl)methanone, 95%, (1,1-Biphenyl)-4-yl(2-chloropyridin-4-yl)methanone, 95%, (1,1–Biphenyl)–4–yl(2–chloropyridin–4–yl)methanone. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
(2-chloro-4-pyridinyl)-(4-phenylphenyl)methanone (CAS 80100-09-0) is a chemical compound with the molecular formula C18H12ClNO and a molecular weight of 293.7 g/mol. IUPAC name: (2-chloro-4-pyridinyl)-(4-phenylphenyl)methanone. InChIKey: SVWNIEJSQQUONV-UHFFFAOYSA-N.
| Molecular formula | C18H12ClNO |
|---|---|
| Molecular weight | 293.7 g/mol |
| IUPAC name | (2-chloro-4-pyridinyl)-(4-phenylphenyl)methanone |
| InChIKey | SVWNIEJSQQUONV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C(=O)C3=CC(=NC=C3)Cl |
Computed by PubChem (NCBI)