CAS 1421599-28-1 is the registry number for N-(2-Chlorophenyl)dibenzo[b,d]furan-4-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(2-chlorophenyl)dibenzofuran-4-amine (CAS 1421599-28-1) is a chemical compound with the molecular formula C18H12ClNO and a molecular weight of 293.7 g/mol. IUPAC name: N-(2-chlorophenyl)dibenzofuran-4-amine. InChIKey: UYAKANIFRJXONP-UHFFFAOYSA-N.
| Molecular formula | C18H12ClNO |
|---|---|
| Molecular weight | 293.7 g/mol |
| IUPAC name | N-(2-chlorophenyl)dibenzofuran-4-amine |
| InChIKey | UYAKANIFRJXONP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(O2)C(=CC=C3)NC4=CC=CC=C4Cl |
Computed by PubChem (NCBI)