Products 115127-09-8
CAS 115127-09-8 is the registry number for (E)-(3-(p-tolyl)acryloyl)glycine, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2-[[(E)-3-(4-methylphenyl)prop-2-enoyl]amino]acetic acid (CAS 115127-09-8) is a chemical compound with the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. IUPAC name: 2-[[(E)-3-(4-methylphenyl)prop-2-enoyl]amino]acetic acid. InChIKey: GDTIURLWKBNWDK-VOTSOKGWSA-N.
| Molecular formula | C12H13NO3 |
|---|---|
| Molecular weight | 219.24 g/mol |
| IUPAC name | 2-[[(E)-3-(4-methylphenyl)prop-2-enoyl]amino]acetic acid |
| InChIKey | GDTIURLWKBNWDK-VOTSOKGWSA-N |
| SMILES | CC1=CC=C(C=C1)/C=C/C(=O)NCC(=O)O |
Computed by PubChem (NCBI)