Products 1151511-05-5
CAS 1151511-05-5 appears in our catalog under these names: Herbaridine B, Herbaridine B. Offered by: GLPBio, MedChemExpress. Available pack sizes: 5mg, Get quote.
(3R,4aS,10aR)-3,7,9-trimethoxy-3-methyl-1,4,4a,10a-tetrahydrobenzo[g]isochromene-5,10-dione (CAS 1151511-05-5) is a chemical compound with the molecular formula C17H20O6 and a molecular weight of 320.3 g/mol. IUPAC name: (3R,4aS,10aR)-3,7,9-trimethoxy-3-methyl-1,4,4a,10a-tetrahydrobenzo[g]isochromene-5,10-dione. InChIKey: XWDPPCCHTXTSRZ-NVGCLXPQSA-N.
| Molecular formula | C17H20O6 |
|---|---|
| Molecular weight | 320.3 g/mol |
| IUPAC name | (3R,4aS,10aR)-3,7,9-trimethoxy-3-methyl-1,4,4a,10a-tetrahydrobenzo[g]isochromene-5,10-dione |
| InChIKey | XWDPPCCHTXTSRZ-NVGCLXPQSA-N |
| SMILES | C[C@@]1(C[C@H]2[C@H](CO1)C(=O)C3=C(C2=O)C=C(C=C3OC)OC)OC |
Computed by PubChem (NCBI)
Synonyms:
Herbaridine B, orb1680943