CAS 1151920-00-1 appears in our catalog under these names: 3-(1-Benzyl-1H-1,2,3-triazol-4-yl)aniline, 95%, 3-(1-Benzyl-1H-1,2,3-triazol-4-yl)aniline. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
3-(1-benzyltriazol-4-yl)aniline (CAS 1151920-00-1) is a chemical compound with the molecular formula C15H14N4 and a molecular weight of 250.30 g/mol. IUPAC name: 3-(1-benzyltriazol-4-yl)aniline. InChIKey: BREZWJGDRJPRCX-UHFFFAOYSA-N.
| Molecular formula | C15H14N4 |
|---|---|
| Molecular weight | 250.30 g/mol |
| IUPAC name | 3-(1-benzyltriazol-4-yl)aniline |
| InChIKey | BREZWJGDRJPRCX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C=C(N=N2)C3=CC(=CC=C3)N |
Computed by PubChem (NCBI)