Products 1152493-53-2
CAS 1152493-53-2 is the registry number for N-(4-Fluoro-3-(2-oxopyrrolidin-1-yl)phenyl)benzamide, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 500mg, 1g, 2,5g, 5g, 10g.
N-[4-fluoro-3-(2-oxopyrrolidin-1-yl)phenyl]benzamide (CAS 1152493-53-2) is a chemical compound with the molecular formula C17H15FN2O2 and a molecular weight of 298.31 g/mol. IUPAC name: N-[4-fluoro-3-(2-oxopyrrolidin-1-yl)phenyl]benzamide. InChIKey: VVTJDFRNGVNLQT-UHFFFAOYSA-N.
| Molecular formula | C17H15FN2O2 |
|---|---|
| Molecular weight | 298.31 g/mol |
| IUPAC name | N-[4-fluoro-3-(2-oxopyrrolidin-1-yl)phenyl]benzamide |
| InChIKey | VVTJDFRNGVNLQT-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1)C2=C(C=CC(=C2)NC(=O)C3=CC=CC=C3)F |
Computed by PubChem (NCBI)