Products 871814-05-0
CAS 871814-05-0 is the registry number for 3-(4-Fluorophenyl)-7-hydroxy-2-isopropylquinazolin-4(3H)-one. Offered by: Biosynth. Available pack sizes: 5000mg.
3-(4-fluorophenyl)-7-hydroxy-2-propan-2-ylquinazolin-4-one (CAS 871814-05-0) is a chemical compound with the molecular formula C17H15FN2O2 and a molecular weight of 298.31 g/mol. IUPAC name: 3-(4-fluorophenyl)-7-hydroxy-2-propan-2-ylquinazolin-4-one. InChIKey: CRZFXIIEHCOWNI-UHFFFAOYSA-N.
| Molecular formula | C17H15FN2O2 |
|---|---|
| Molecular weight | 298.31 g/mol |
| IUPAC name | 3-(4-fluorophenyl)-7-hydroxy-2-propan-2-ylquinazolin-4-one |
| InChIKey | CRZFXIIEHCOWNI-UHFFFAOYSA-N |
| SMILES | CC(C)C1=NC2=C(C=CC(=C2)O)C(=O)N1C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)