CAS 1152498-93-5 appears in our catalog under these names: 5-(4-Chloro-2-fluorophenyl)-3-(chloromethyl)-1,2,4-oxadiazole, 95%, 5-(4-Chloro-2-fluorophenyl)-3-(chloromethyl)-1,2,4-oxadiazole. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
5-(4-chloro-2-fluorophenyl)-3-(chloromethyl)-1,2,4-oxadiazole (CAS 1152498-93-5) is a chemical compound with the molecular formula C9H5Cl2FN2O and a molecular weight of 247.05 g/mol. IUPAC name: 5-(4-chloro-2-fluorophenyl)-3-(chloromethyl)-1,2,4-oxadiazole. InChIKey: BHQPGUWKTUMWJH-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2FN2O |
|---|---|
| Molecular weight | 247.05 g/mol |
| IUPAC name | 5-(4-chloro-2-fluorophenyl)-3-(chloromethyl)-1,2,4-oxadiazole |
| InChIKey | BHQPGUWKTUMWJH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)F)C2=NC(=NO2)CCl |
Computed by PubChem (NCBI)