Products 864291-35-0
CAS 864291-35-0 is the registry number for 2,4-Dichloro-6-fluoro-7-methoxyquinazoline, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2,4-dichloro-6-fluoro-7-methoxyquinazoline (CAS 864291-35-0) is a chemical compound with the molecular formula C9H5Cl2FN2O and a molecular weight of 247.05 g/mol. IUPAC name: 2,4-dichloro-6-fluoro-7-methoxyquinazoline. InChIKey: JSEUWOYTQGIHSV-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2FN2O |
|---|---|
| Molecular weight | 247.05 g/mol |
| IUPAC name | 2,4-dichloro-6-fluoro-7-methoxyquinazoline |
| InChIKey | JSEUWOYTQGIHSV-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)N=C(N=C2Cl)Cl)F |
Computed by PubChem (NCBI)