CAS 1152504-93-2 appears in our catalog under these names: 3-(Chloromethyl)-5-(4-methyl-1,3-thiazol-5-yl)-1,2,4-oxadiazole, 95%, 3-(Chloromethyl)-5-(4-methyl-1,3-thiazol-5-yl)-1,2,4-oxadiazole. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
3-(chloromethyl)-5-(4-methyl-1,3-thiazol-5-yl)-1,2,4-oxadiazole (CAS 1152504-93-2) is a chemical compound with the molecular formula C7H6ClN3OS and a molecular weight of 215.66 g/mol. IUPAC name: 3-(chloromethyl)-5-(4-methyl-1,3-thiazol-5-yl)-1,2,4-oxadiazole. InChIKey: NYKGFBWDZHIKEH-UHFFFAOYSA-N.
| Molecular formula | C7H6ClN3OS |
|---|---|
| Molecular weight | 215.66 g/mol |
| IUPAC name | 3-(chloromethyl)-5-(4-methyl-1,3-thiazol-5-yl)-1,2,4-oxadiazole |
| InChIKey | NYKGFBWDZHIKEH-UHFFFAOYSA-N |
| SMILES | CC1=C(SC=N1)C2=NC(=NO2)CCl |
Computed by PubChem (NCBI)