Products 20015-72-9
CAS 20015-72-9 is the registry number for 4-Chloro-5-methyl-5H-pyrimido[4,5-b][1,4]thiazin-6(7H)-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-chloro-5-methylpyrimido[4,5-b][1,4]thiazin-6-one (CAS 20015-72-9) is a chemical compound with the molecular formula C7H6ClN3OS and a molecular weight of 215.66 g/mol. IUPAC name: 4-chloro-5-methylpyrimido[4,5-b][1,4]thiazin-6-one. InChIKey: MOELXUDRYRKAIV-UHFFFAOYSA-N.
| Molecular formula | C7H6ClN3OS |
|---|---|
| Molecular weight | 215.66 g/mol |
| IUPAC name | 4-chloro-5-methylpyrimido[4,5-b][1,4]thiazin-6-one |
| InChIKey | MOELXUDRYRKAIV-UHFFFAOYSA-N |
| SMILES | CN1C(=O)CSC2=C1C(=NC=N2)Cl |
Computed by PubChem (NCBI)