CAS 81516-46-3 is the registry number for 2-(Chloromethyl)-7-methyl-5H-(1,3,4)thiadiazolo(3,2-a)pyrimidin-5-one, 97%. Offered by: AmBeed. Available pack sizes: 5g, 10g.
2-(chloromethyl)-7-methyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one (CAS 81516-46-3) is a chemical compound with the molecular formula C7H6ClN3OS and a molecular weight of 215.66 g/mol. IUPAC name: 2-(chloromethyl)-7-methyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one. InChIKey: NZAXHQJYIYHPFL-UHFFFAOYSA-N.
| Molecular formula | C7H6ClN3OS |
|---|---|
| Molecular weight | 215.66 g/mol |
| IUPAC name | 2-(chloromethyl)-7-methyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one |
| InChIKey | NZAXHQJYIYHPFL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)N2C(=N1)SC(=N2)CCl |
Computed by PubChem (NCBI)