Products 1152514-20-9
CAS 1152514-20-9 is the registry number for 3-(5-(Oxolan-2-yl)-1,2,4-oxadiazol-3-yl)phenol. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-[5-(oxolan-2-yl)-1,2,4-oxadiazol-3-yl]phenol (CAS 1152514-20-9) is a chemical compound with the molecular formula C12H12N2O3 and a molecular weight of 232.23 g/mol. IUPAC name: 3-[5-(oxolan-2-yl)-1,2,4-oxadiazol-3-yl]phenol. InChIKey: YMKQTBBXJASVGX-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O3 |
|---|---|
| Molecular weight | 232.23 g/mol |
| IUPAC name | 3-[5-(oxolan-2-yl)-1,2,4-oxadiazol-3-yl]phenol |
| InChIKey | YMKQTBBXJASVGX-UHFFFAOYSA-N |
| SMILES | C1CC(OC1)C2=NC(=NO2)C3=CC(=CC=C3)O |
Computed by PubChem (NCBI)