CAS 1152521-09-9 appears in our catalog under these names: 2-(4-Chloro-2-nitrophenyl)-5-(chloromethyl)-1,3,4-oxadiazole, 95%, 2-(4-Chloro-2-nitrophenyl)-5-(chloromethyl)-1,3,4-oxadiazole. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
2-(chloromethyl)-5-(4-chloro-2-nitrophenyl)-1,3,4-oxadiazole (CAS 1152521-09-9) is a chemical compound with the molecular formula C9H5Cl2N3O3 and a molecular weight of 274.06 g/mol. IUPAC name: 2-(chloromethyl)-5-(4-chloro-2-nitrophenyl)-1,3,4-oxadiazole. InChIKey: KKMRQTLKPLRCJD-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2N3O3 |
|---|---|
| Molecular weight | 274.06 g/mol |
| IUPAC name | 2-(chloromethyl)-5-(4-chloro-2-nitrophenyl)-1,3,4-oxadiazole |
| InChIKey | KKMRQTLKPLRCJD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)[N+](=O)[O-])C2=NN=C(O2)CCl |
Computed by PubChem (NCBI)