Products 2542040-61-7
CAS 2542040-61-7 is the registry number for 2-(3,5-Dichloro-4-hydroxyphenyl)-1,2,4-triazine-3,5(2H,4H)-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(3,5-dichloro-4-hydroxyphenyl)-1,2,4-triazine-3,5-dione (CAS 2542040-61-7) is a chemical compound with the molecular formula C9H5Cl2N3O3 and a molecular weight of 274.06 g/mol. IUPAC name: 2-(3,5-dichloro-4-hydroxyphenyl)-1,2,4-triazine-3,5-dione. InChIKey: ZCSSCCNATAHVMY-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2N3O3 |
|---|---|
| Molecular weight | 274.06 g/mol |
| IUPAC name | 2-(3,5-dichloro-4-hydroxyphenyl)-1,2,4-triazine-3,5-dione |
| InChIKey | ZCSSCCNATAHVMY-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)O)Cl)N2C(=O)NC(=O)C=N2 |
Computed by PubChem (NCBI)