CAS 187399-90-2 appears in our catalog under these names: 5-Chloromethyl-3-(4-chloro-3-nitro-phenyl)-[1,2,4]oxadiazole, 95%, 3-(4-Chloro-3-nitrophenyl)-5-(chloromethyl)-1,2,4-oxadiazole, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 25g.
5-(chloromethyl)-3-(4-chloro-3-nitrophenyl)-1,2,4-oxadiazole (CAS 187399-90-2) is a chemical compound with the molecular formula C9H5Cl2N3O3 and a molecular weight of 274.06 g/mol. IUPAC name: 5-(chloromethyl)-3-(4-chloro-3-nitrophenyl)-1,2,4-oxadiazole. InChIKey: HKXJMFKBDCJXFP-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2N3O3 |
|---|---|
| Molecular weight | 274.06 g/mol |
| IUPAC name | 5-(chloromethyl)-3-(4-chloro-3-nitrophenyl)-1,2,4-oxadiazole |
| InChIKey | HKXJMFKBDCJXFP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=NOC(=N2)CCl)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)