CAS 1152526-82-3 is the registry number for 1-(3-Bromobenzyl)-4-methyl-1h-pyrazol-5-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
1-[(3-bromophenyl)methyl]-4-methylpyrazol-5-amine (CAS 1152526-82-3) is a chemical compound with the molecular formula C11H12BrN3 and a molecular weight of 266.14 g/mol. IUPAC name: 1-[(3-bromophenyl)methyl]-4-methylpyrazol-5-amine. InChIKey: ZQKIUQGEEYZIFC-UHFFFAOYSA-N.
| Molecular formula | C11H12BrN3 |
|---|---|
| Molecular weight | 266.14 g/mol |
| IUPAC name | 1-[(3-bromophenyl)methyl]-4-methylpyrazol-5-amine |
| InChIKey | ZQKIUQGEEYZIFC-UHFFFAOYSA-N |
| SMILES | CC1=C(N(N=C1)CC2=CC(=CC=C2)Br)N |
Computed by PubChem (NCBI)