CAS 1152678-01-7 is the registry number for 4-(4-Bromophenyl)-2,5-dimethylpyrazol-3-amine, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
4-(4-bromophenyl)-1,3-dimethylpyrazol-5-amine (CAS 1152678-01-7) is a chemical compound with the molecular formula C11H12BrN3 and a molecular weight of 266.14 g/mol. IUPAC name: 4-(4-bromophenyl)-1,3-dimethylpyrazol-5-amine. InChIKey: RYEVCRZPUXDJLP-UHFFFAOYSA-N.
| Molecular formula | C11H12BrN3 |
|---|---|
| Molecular weight | 266.14 g/mol |
| IUPAC name | 4-(4-bromophenyl)-1,3-dimethylpyrazol-5-amine |
| InChIKey | RYEVCRZPUXDJLP-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=C1C2=CC=C(C=C2)Br)N)C |
Computed by PubChem (NCBI)