CAS 1550367-95-7 is the registry number for 3-(3-Bromophenyl)-4-isopropyl-4H-1,2,4-triazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(3-bromophenyl)-4-propan-2-yl-1,2,4-triazole (CAS 1550367-95-7) is a chemical compound with the molecular formula C11H12BrN3 and a molecular weight of 266.14 g/mol. IUPAC name: 3-(3-bromophenyl)-4-propan-2-yl-1,2,4-triazole. InChIKey: SOEMDKWWPUWCSQ-UHFFFAOYSA-N.
| Molecular formula | C11H12BrN3 |
|---|---|
| Molecular weight | 266.14 g/mol |
| IUPAC name | 3-(3-bromophenyl)-4-propan-2-yl-1,2,4-triazole |
| InChIKey | SOEMDKWWPUWCSQ-UHFFFAOYSA-N |
| SMILES | CC(C)N1C=NN=C1C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)