Products 1152538-80-1
CAS 1152538-80-1 appears in our catalog under these names: 7-Iodobenzo[d][1,3]dioxole-5-carbaldehyde, 98%, 98%, 7-Iodobenzo[d][1,3]dioxole-5-carbaldehyde, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
7-iodo-1,3-benzodioxole-5-carbaldehyde (CAS 1152538-80-1) is a chemical compound with the molecular formula C8H5IO3 and a molecular weight of 276.03 g/mol. IUPAC name: 7-iodo-1,3-benzodioxole-5-carbaldehyde. InChIKey: PRYDNEPQUGCULA-UHFFFAOYSA-N.
| Molecular formula | C8H5IO3 |
|---|---|
| Molecular weight | 276.03 g/mol |
| IUPAC name | 7-iodo-1,3-benzodioxole-5-carbaldehyde |
| InChIKey | PRYDNEPQUGCULA-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C(=CC(=C2)C=O)I |
Computed by PubChem (NCBI)