Products 1289015-17-3
CAS 1289015-17-3 appears in our catalog under these names: 3-Formyl-5-iodobenzoic acid, 3-Formyl-5-iodobenzoic acid, 95%, 3-Formyl-5-iodobenzoic acid, 97%. Offered by: Biosynth, Ambeed, BLDpharm, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 5g, 10g.
3-formyl-5-iodobenzoic acid (CAS 1289015-17-3) is a chemical compound with the molecular formula C8H5IO3 and a molecular weight of 276.03 g/mol. IUPAC name: 3-formyl-5-iodobenzoic acid. InChIKey: KXXFEXDZTIEBMU-UHFFFAOYSA-N.
| Molecular formula | C8H5IO3 |
|---|---|
| Molecular weight | 276.03 g/mol |
| IUPAC name | 3-formyl-5-iodobenzoic acid |
| InChIKey | KXXFEXDZTIEBMU-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(=O)O)I)C=O |
Computed by PubChem (NCBI)
Synonyms:
3-formyl-5-iodo-benzoic acid