CAS 58343-53-6 is the registry number for 6-Iodobenzo(d)(1,3)dioxole-5-carbaldehyde, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g.
6-iodo-1,3-benzodioxole-5-carbaldehyde (CAS 58343-53-6) is a chemical compound with the molecular formula C8H5IO3 and a molecular weight of 276.03 g/mol. IUPAC name: 6-iodo-1,3-benzodioxole-5-carbaldehyde. InChIKey: TXKHPPMWTDBGHL-UHFFFAOYSA-N.
| Molecular formula | C8H5IO3 |
|---|---|
| Molecular weight | 276.03 g/mol |
| IUPAC name | 6-iodo-1,3-benzodioxole-5-carbaldehyde |
| InChIKey | TXKHPPMWTDBGHL-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C(=C2)C=O)I |
Computed by PubChem (NCBI)